C31H35N7O4 — CID 59969728
N-[[(2R)-1-[2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]acetyl]pyrrolidin-2-yl]methyl]benzamide (PubChem CID 59969728) has the molecular formula C31H35N7O4 and a molecular weight of 569.67 g/mol. Its IUPAC name is N-[[(2R)-1-[2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]acetyl]pyrrolidin-2-yl]methyl]benzamide.
| Compound Name | N-[[(2R)-1-[2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]acetyl]pyrrolidin-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 59969728 |
| Molecular Formula | C31H35N7O4 |
| Molecular Weight | 569.67 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | N-[[(2R)-1-[2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]acetyl]pyrrolidin-2-yl]methyl]benzamide |
| SMILES | Cc1cc2cc(N/C(=N/[C@H]3CCCCN(CC(=O)N4CCC[C@@H]4CNC(=O)c4ccccc4)C3=O)NC#N)ccc2o1 |
| InChI | InChI=1S/C31H35N7O4/c1-21-16-23-17-24(12-13-27(23)42-21)35-31(34-20-32)36-26-11-5-6-14-37(30(26)41)19-28(39)38-15-7-10-25(38)18-33-29(40)22-8-3-2-4-9-22/h2-4,8-9,12-13,16-17,25-26H,5-7,10-11,14-15,18-19H2,1H3,(H,33,40)(H2,34,35,36)/t25-,26+/m1/s1 |
| InChIKey | DQSPBTNIRQEMQU-FTJBHMTQSA-N |
| XLogP | 3.38 |
| TPSA | 143.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.67 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|