C30H35N7O5S — CID 20690962
2-[1-[2-[2-(benzenesulfonamidomethyl)pyrrolidin-1-yl]-2-oxoethyl]-2-oxoazepan-3-yl]-1-cyano-3-(2-methyl-1-benzofuran-5-yl)guanidine (PubChem CID 20690962) has the molecular formula C30H35N7O5S and a molecular weight of 605.72 g/mol. Its IUPAC name is 2-[1-[2-[2-(benzenesulfonamidomethyl)pyrrolidin-1-yl]-2-oxoethyl]-2-oxoazepan-3-yl]-1-cyano-3-(2-methyl-1-benzofuran-5-yl)guanidine.
| Compound Name | 2-[1-[2-[2-(benzenesulfonamidomethyl)pyrrolidin-1-yl]-2-oxoethyl]-2-oxoazepan-3-yl]-1-cyano-3-(2-methyl-1-benzofuran-5-yl)guanidine |
|---|---|
| PubChem CID | 20690962 |
| Molecular Formula | C30H35N7O5S |
| Molecular Weight | 605.72 g/mol |
| Exact Mass | 605.24 |
| IUPAC Name | 2-[1-[2-[2-(benzenesulfonamidomethyl)pyrrolidin-1-yl]-2-oxoethyl]-2-oxoazepan-3-yl]-1-cyano-3-(2-methyl-1-benzofuran-5-yl)guanidine |
| SMILES | Cc1cc2cc(N/C(=N/C3CCCCN(CC(=O)N4CCCC4CNS(=O)(=O)c4ccccc4)C3=O)NC#N)ccc2o1 |
| InChI | InChI=1S/C30H35N7O5S/c1-21-16-22-17-23(12-13-27(22)42-21)34-30(32-20-31)35-26-11-5-6-14-36(29(26)39)19-28(38)37-15-7-8-24(37)18-33-43(40,41)25-9-3-2-4-10-25/h2-4,9-10,12-13,16-17,24,26,33H,5-8,11,14-15,18-19H2,1H3,(H2,32,34,35) |
| InChIKey | YAQREDWERHILRR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 160.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.72 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|