C26H27FN6O3 — CID 59970024
2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]-N-[(2-fluorophenyl)methyl]acetamide (PubChem CID 59970024) has the molecular formula C26H27FN6O3 and a molecular weight of 490.54 g/mol. Its IUPAC name is 2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]-N-[(2-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]-N-[(2-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 59970024 |
| Molecular Formula | C26H27FN6O3 |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]-N-[(2-fluorophenyl)methyl]acetamide |
| SMILES | Cc1cc2cc(N/C(=N/[C@H]3CCCCN(CC(=O)NCc4ccccc4F)C3=O)NC#N)ccc2o1 |
| InChI | InChI=1S/C26H27FN6O3/c1-17-12-19-13-20(9-10-23(19)36-17)31-26(30-16-28)32-22-8-4-5-11-33(25(22)35)15-24(34)29-14-18-6-2-3-7-21(18)27/h2-3,6-7,9-10,12-13,22H,4-5,8,11,14-15H2,1H3,(H,29,34)(H2,30,31,32)/t22-/m0/s1 |
| InChIKey | HSLULTXPUVQJKF-QFIPXVFZSA-N |
| XLogP | 3.42 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|