C28H32N6O4 — CID 59970082
2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]-N-[2-(2-methoxyphenyl)ethyl]acetamide (PubChem CID 59970082) has the molecular formula C28H32N6O4 and a molecular weight of 516.60 g/mol. Its IUPAC name is 2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]-N-[2-(2-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]-N-[2-(2-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 59970082 |
| Molecular Formula | C28H32N6O4 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]-N-[2-(2-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccccc1CCNC(=O)CN1CCCC[C@H](/N=C(\NC#N)Nc2ccc3oc(C)cc3c2)C1=O |
| InChI | InChI=1S/C28H32N6O4/c1-19-15-21-16-22(10-11-25(21)38-19)32-28(31-18-29)33-23-8-5-6-14-34(27(23)36)17-26(35)30-13-12-20-7-3-4-9-24(20)37-2/h3-4,7,9-11,15-16,23H,5-6,8,12-14,17H2,1-2H3,(H,30,35)(H2,31,32,33)/t23-/m0/s1 |
| InChIKey | QYVXOJFAUCDORQ-QHCPKHFHSA-N |
| XLogP | 3.33 |
| TPSA | 131.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|