C27H28Cl2N6O3 — CID 59969874
2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]-N-[2-(2,4-dichlorophenyl)ethyl]acetamide (PubChem CID 59969874) has the molecular formula C27H28Cl2N6O3 and a molecular weight of 555.47 g/mol. Its IUPAC name is 2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]-N-[2-(2,4-dichlorophenyl)ethyl]acetamide.
| Compound Name | 2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]-N-[2-(2,4-dichlorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 59969874 |
| Molecular Formula | C27H28Cl2N6O3 |
| Molecular Weight | 555.47 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | 2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]-N-[2-(2,4-dichlorophenyl)ethyl]acetamide |
| SMILES | Cc1cc2cc(N/C(=N/[C@H]3CCCCN(CC(=O)NCCc4ccc(Cl)cc4Cl)C3=O)NC#N)ccc2o1 |
| InChI | InChI=1S/C27H28Cl2N6O3/c1-17-12-19-13-21(7-8-24(19)38-17)33-27(32-16-30)34-23-4-2-3-11-35(26(23)37)15-25(36)31-10-9-18-5-6-20(28)14-22(18)29/h5-8,12-14,23H,2-4,9-11,15H2,1H3,(H,31,36)(H2,32,33,34)/t23-/m0/s1 |
| InChIKey | SVXDJUKEMGPGJP-QHCPKHFHSA-N |
| XLogP | 4.63 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|