C26H26Cl2N6O3 — CID 59969861
2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]-N-[(3,4-dichlorophenyl)methyl]acetamide (PubChem CID 59969861) has the molecular formula C26H26Cl2N6O3 and a molecular weight of 541.44 g/mol. Its IUPAC name is 2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]-N-[(3,4-dichlorophenyl)methyl]acetamide.
| Compound Name | 2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]-N-[(3,4-dichlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 59969861 |
| Molecular Formula | C26H26Cl2N6O3 |
| Molecular Weight | 541.44 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | 2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]-N-[(3,4-dichlorophenyl)methyl]acetamide |
| SMILES | Cc1cc2cc(N/C(=N/[C@H]3CCCCN(CC(=O)NCc4ccc(Cl)c(Cl)c4)C3=O)NC#N)ccc2o1 |
| InChI | InChI=1S/C26H26Cl2N6O3/c1-16-10-18-12-19(6-8-23(18)37-16)32-26(31-15-29)33-22-4-2-3-9-34(25(22)36)14-24(35)30-13-17-5-7-20(27)21(28)11-17/h5-8,10-12,22H,2-4,9,13-14H2,1H3,(H,30,35)(H2,31,32,33)/t22-/m0/s1 |
| InChIKey | JKJMLFLREWOLNI-QFIPXVFZSA-N |
| XLogP | 4.58 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|