C21H29N5O4 — CID 70033140
(3S)-3-[[1-(4-methylanilino)-2-nitroethenyl]amino]-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-2-one (PubChem CID 70033140) has the molecular formula C21H29N5O4 and a molecular weight of 415.49 g/mol. Its IUPAC name is (3S)-3-[[1-(4-methylanilino)-2-nitroethenyl]amino]-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-2-one.
| Compound Name | (3S)-3-[[1-(4-methylanilino)-2-nitroethenyl]amino]-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-2-one |
|---|---|
| PubChem CID | 70033140 |
| Molecular Formula | C21H29N5O4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | (3S)-3-[[1-(4-methylanilino)-2-nitroethenyl]amino]-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-2-one |
| SMILES | Cc1ccc(NC(=C[N+](=O)[O-])N[C@H]2CCCCN(CC(=O)N3CCCC3)C2=O)cc1 |
| InChI | InChI=1S/C21H29N5O4/c1-16-7-9-17(10-8-16)22-19(14-26(29)30)23-18-6-2-3-13-25(21(18)28)15-20(27)24-11-4-5-12-24/h7-10,14,18,22-23H,2-6,11-13,15H2,1H3/t18-/m0/s1 |
| InChIKey | YGBWQSGHMWXQDK-SFHVURJKSA-N |
| XLogP | 2.08 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|