C19H25ClN4O2S — CID 22945833
1-(2-chlorophenyl)-3-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]thiourea (PubChem CID 22945833) has the molecular formula C19H25ClN4O2S and a molecular weight of 408.96 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]thiourea.
| Compound Name | 1-(2-chlorophenyl)-3-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]thiourea |
|---|---|
| PubChem CID | 22945833 |
| Molecular Formula | C19H25ClN4O2S |
| Molecular Weight | 408.96 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]thiourea |
| SMILES | O=C(CN1CCCCC(NC(=S)Nc2ccccc2Cl)C1=O)N1CCCC1 |
| InChI | InChI=1S/C19H25ClN4O2S/c20-14-7-1-2-8-15(14)21-19(27)22-16-9-3-4-12-24(18(16)26)13-17(25)23-10-5-6-11-23/h1-2,7-8,16H,3-6,9-13H2,(H2,21,22,27) |
| InChIKey | MHZVWKKPASYXJA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.96 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|