C20H27N5O4 — CID 18612616
3-[[(E)-1-anilino-2-nitroethenyl]amino]-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-2-one (PubChem CID 18612616) has the molecular formula C20H27N5O4 and a molecular weight of 401.47 g/mol. Its IUPAC name is 3-[[(E)-1-anilino-2-nitroethenyl]amino]-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-2-one.
| Compound Name | 3-[[(E)-1-anilino-2-nitroethenyl]amino]-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-2-one |
|---|---|
| PubChem CID | 18612616 |
| Molecular Formula | C20H27N5O4 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 3-[[(E)-1-anilino-2-nitroethenyl]amino]-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-2-one |
| SMILES | O=C(CN1CCCCC(N/C(=C\[N+](=O)[O-])Nc2ccccc2)C1=O)N1CCCC1 |
| InChI | InChI=1S/C20H27N5O4/c26-19(23-11-6-7-12-23)15-24-13-5-4-10-17(20(24)27)22-18(14-25(28)29)21-16-8-2-1-3-9-16/h1-3,8-9,14,17,21-22H,4-7,10-13,15H2/b18-14- |
| InChIKey | BLAMGKZNSCFCSV-JXAWBTAJSA-N |
| XLogP | 1.77 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|