C22H26N6O2 — CID 59049432
(Z)-3-anilino-2-isocyano-3-[[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]amino]prop-2-enenitrile (PubChem CID 59049432) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is (Z)-3-anilino-2-isocyano-3-[[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]amino]prop-2-enenitrile.
| Compound Name | (Z)-3-anilino-2-isocyano-3-[[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]amino]prop-2-enenitrile |
|---|---|
| PubChem CID | 59049432 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | (Z)-3-anilino-2-isocyano-3-[[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]amino]prop-2-enenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C(\Nc1ccccc1)NC1CCCCN(CC(=O)N2CCCC2)C1=O |
| InChI | InChI=1S/C22H26N6O2/c1-24-19(15-23)21(25-17-9-3-2-4-10-17)26-18-11-5-6-14-28(22(18)30)16-20(29)27-12-7-8-13-27/h2-4,9-10,18,25-26H,5-8,11-14,16H2/b21-19+ |
| InChIKey | WSESZKVVVOCGQW-XUTLUUPISA-N |
| XLogP | 2.30 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|