C25H29ClN6O4 — CID 59049425
methyl (Z)-3-[(3-chloro-1H-indol-6-yl)amino]-2-cyano-3-[[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]amino]prop-2-enoate (PubChem CID 59049425) has the molecular formula C25H29ClN6O4 and a molecular weight of 513.00 g/mol. Its IUPAC name is methyl (Z)-3-[(3-chloro-1H-indol-6-yl)amino]-2-cyano-3-[[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]amino]prop-2-enoate.
| Compound Name | methyl (Z)-3-[(3-chloro-1H-indol-6-yl)amino]-2-cyano-3-[[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]amino]prop-2-enoate |
|---|---|
| PubChem CID | 59049425 |
| Molecular Formula | C25H29ClN6O4 |
| Molecular Weight | 513.00 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | methyl (Z)-3-[(3-chloro-1H-indol-6-yl)amino]-2-cyano-3-[[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]amino]prop-2-enoate |
| SMILES | COC(=O)/C(C#N)=C(\Nc1ccc2c(Cl)c[nH]c2c1)N[C@H]1CCCCN(CC(=O)N2CCCC2)C1=O |
| InChI | InChI=1S/C25H29ClN6O4/c1-36-25(35)18(13-27)23(29-16-7-8-17-19(26)14-28-21(17)12-16)30-20-6-2-3-11-32(24(20)34)15-22(33)31-9-4-5-10-31/h7-8,12,14,20,28-30H,2-6,9-11,15H2,1H3/b23-18+/t20-/m0/s1 |
| InChIKey | SESJBBBFIVZQEO-KNOQIOAQSA-N |
| XLogP | 2.73 |
| TPSA | 130.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.00 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|