C34H38N6O5 — CID 70029957
3-[(Z)-2-cyano-3-[(2-methyl-1-benzofuran-5-yl)amino]-3-[[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]amino]prop-2-enoyl]-N-ethylbenzamide (PubChem CID 70029957) has the molecular formula C34H38N6O5 and a molecular weight of 610.72 g/mol. Its IUPAC name is 3-[(Z)-2-cyano-3-[(2-methyl-1-benzofuran-5-yl)amino]-3-[[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]amino]prop-2-enoyl]-N-ethylbenzamide.
| Compound Name | 3-[(Z)-2-cyano-3-[(2-methyl-1-benzofuran-5-yl)amino]-3-[[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]amino]prop-2-enoyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 70029957 |
| Molecular Formula | C34H38N6O5 |
| Molecular Weight | 610.72 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | 3-[(Z)-2-cyano-3-[(2-methyl-1-benzofuran-5-yl)amino]-3-[[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]amino]prop-2-enoyl]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(C(=O)/C(C#N)=C(\Nc2ccc3oc(C)cc3c2)N[C@H]2CCCCN(CC(=O)N3CCCC3)C2=O)c1 |
| InChI | InChI=1S/C34H38N6O5/c1-3-36-33(43)24-10-8-9-23(18-24)31(42)27(20-35)32(37-26-12-13-29-25(19-26)17-22(2)45-29)38-28-11-4-5-16-40(34(28)44)21-30(41)39-14-6-7-15-39/h8-10,12-13,17-19,28,37-38H,3-7,11,14-16,21H2,1-2H3,(H,36,43)/b32-27+/t28-/m0/s1 |
| InChIKey | CPIYYLHPRPEEHF-BTCYUKQASA-N |
| XLogP | 4.11 |
| TPSA | 147.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.72 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|