C34H38N6O5 — CID 70030289
4-[2-cyano-3-[(2-methyl-1-benzofuran-5-yl)amino]-3-[[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]amino]prop-2-enoyl]-N,N-dimethylbenzamide (PubChem CID 70030289) has the molecular formula C34H38N6O5 and a molecular weight of 610.72 g/mol. Its IUPAC name is 4-[2-cyano-3-[(2-methyl-1-benzofuran-5-yl)amino]-3-[[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]amino]prop-2-enoyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[2-cyano-3-[(2-methyl-1-benzofuran-5-yl)amino]-3-[[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]amino]prop-2-enoyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 70030289 |
| Molecular Formula | C34H38N6O5 |
| Molecular Weight | 610.72 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | 4-[2-cyano-3-[(2-methyl-1-benzofuran-5-yl)amino]-3-[[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]amino]prop-2-enoyl]-N,N-dimethylbenzamide |
| SMILES | Cc1cc2cc(NC(N[C@H]3CCCCN(CC(=O)N4CCCC4)C3=O)=C(C#N)C(=O)c3ccc(C(=O)N(C)C)cc3)ccc2o1 |
| InChI | InChI=1S/C34H38N6O5/c1-22-18-25-19-26(13-14-29(25)45-22)36-32(27(20-35)31(42)23-9-11-24(12-10-23)33(43)38(2)3)37-28-8-4-5-17-40(34(28)44)21-30(41)39-15-6-7-16-39/h9-14,18-19,28,36-37H,4-8,15-17,21H2,1-3H3/t28-/m0/s1 |
| InChIKey | IZMOXAVAYPRQEJ-NDEPHWFRSA-N |
| XLogP | 4.07 |
| TPSA | 138.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.72 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|