C33H46N4O7 — CID 59049369
ditert-butyl 2-[[(2-methyl-1-benzofuran-5-yl)amino]-[[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]amino]methylidene]propanedioate (PubChem CID 59049369) has the molecular formula C33H46N4O7 and a molecular weight of 610.75 g/mol. Its IUPAC name is ditert-butyl 2-[[(2-methyl-1-benzofuran-5-yl)amino]-[[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]amino]methylidene]propanedioate.
| Compound Name | ditert-butyl 2-[[(2-methyl-1-benzofuran-5-yl)amino]-[[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 59049369 |
| Molecular Formula | C33H46N4O7 |
| Molecular Weight | 610.75 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | ditert-butyl 2-[[(2-methyl-1-benzofuran-5-yl)amino]-[[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]amino]methylidene]propanedioate |
| SMILES | Cc1cc2cc(NC(N[C@H]3CCCCN(CC(=O)N4CCCC4)C3=O)=C(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)ccc2o1 |
| InChI | InChI=1S/C33H46N4O7/c1-21-18-22-19-23(13-14-25(22)42-21)34-28(27(30(40)43-32(2,3)4)31(41)44-33(5,6)7)35-24-12-8-9-17-37(29(24)39)20-26(38)36-15-10-11-16-36/h13-14,18-19,24,34-35H,8-12,15-17,20H2,1-7H3/t24-/m0/s1 |
| InChIKey | XKGIPJXQKNGWFD-DEOSSOPVSA-N |
| XLogP | 4.64 |
| TPSA | 130.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.75 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|