C17H29N3O4 — CID 59969833
tert-butyl N-[(3R)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]carbamate (PubChem CID 59969833) has the molecular formula C17H29N3O4 and a molecular weight of 339.44 g/mol. Its IUPAC name is tert-butyl N-[(3R)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]carbamate |
|---|---|
| PubChem CID | 59969833 |
| Molecular Formula | C17H29N3O4 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | tert-butyl N-[(3R)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCCN(CC(=O)N2CCCC2)C1=O |
| InChI | InChI=1S/C17H29N3O4/c1-17(2,3)24-16(23)18-13-8-4-5-11-20(15(13)22)12-14(21)19-9-6-7-10-19/h13H,4-12H2,1-3H3,(H,18,23)/t13-/m1/s1 |
| InChIKey | QVLYIRBKQXAKSY-CYBMUJFWSA-N |
| XLogP | 1.51 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |