C15H26N2O5 — CID 10615174
ethyl 2-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazepan-1-yl]acetate (PubChem CID 10615174) has the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. Its IUPAC name is ethyl 2-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazepan-1-yl]acetate.
| Compound Name | ethyl 2-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazepan-1-yl]acetate |
|---|---|
| PubChem CID | 10615174 |
| Molecular Formula | C15H26N2O5 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | ethyl 2-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazepan-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCCC[C@H](NC(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C15H26N2O5/c1-5-21-12(18)10-17-9-7-6-8-11(13(17)19)16-14(20)22-15(2,3)4/h11H,5-10H2,1-4H3,(H,16,20)/t11-/m0/s1 |
| InChIKey | NIDWMBCZNSGMPH-NSHDSACASA-N |
| XLogP | 1.46 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |