C14H23ClN2O5 — CID 165439966
chloromethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazepan-1-yl]acetate (PubChem CID 165439966) has the molecular formula C14H23ClN2O5 and a molecular weight of 334.80 g/mol. Its IUPAC name is chloromethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazepan-1-yl]acetate.
| Compound Name | chloromethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazepan-1-yl]acetate |
|---|---|
| PubChem CID | 165439966 |
| Molecular Formula | C14H23ClN2O5 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | chloromethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazepan-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)NC1CCCCN(CC(=O)OCCl)C1=O |
| InChI | InChI=1S/C14H23ClN2O5/c1-14(2,3)22-13(20)16-10-6-4-5-7-17(12(10)19)8-11(18)21-9-15/h10H,4-9H2,1-3H3,(H,16,20) |
| InChIKey | MEYCGEQCRULEOG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|