C22H32N6O4 — CID 91544563
N-[3-(dimethylamino)phenyl]-2-nitro-N'-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]ethanimidamide (PubChem CID 91544563) has the molecular formula C22H32N6O4 and a molecular weight of 444.54 g/mol. Its IUPAC name is N-[3-(dimethylamino)phenyl]-2-nitro-N'-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]ethanimidamide.
| Compound Name | N-[3-(dimethylamino)phenyl]-2-nitro-N'-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]ethanimidamide |
|---|---|
| PubChem CID | 91544563 |
| Molecular Formula | C22H32N6O4 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | N-[3-(dimethylamino)phenyl]-2-nitro-N'-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]ethanimidamide |
| SMILES | CN(C)c1cccc(N/C(C[N+](=O)[O-])=N/C2CCCCN(CC(=O)N3CCCC3)C2=O)c1 |
| InChI | InChI=1S/C22H32N6O4/c1-25(2)18-9-7-8-17(14-18)23-20(15-28(31)32)24-19-10-3-4-13-27(22(19)30)16-21(29)26-11-5-6-12-26/h7-9,14,19H,3-6,10-13,15-16H2,1-2H3,(H,23,24) |
| InChIKey | RINWDOCSSXRJPR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|