C23H24N4O6 — CID 91390411
N'-[(3S)-1-[2-(furan-3-yl)-2-oxoethyl]-2-oxoazepan-3-yl]-N-(2-methyl-1-benzofuran-5-yl)-2-nitroethanimidamide (PubChem CID 91390411) has the molecular formula C23H24N4O6 and a molecular weight of 452.47 g/mol. Its IUPAC name is N'-[(3S)-1-[2-(furan-3-yl)-2-oxoethyl]-2-oxoazepan-3-yl]-N-(2-methyl-1-benzofuran-5-yl)-2-nitroethanimidamide.
| Compound Name | N'-[(3S)-1-[2-(furan-3-yl)-2-oxoethyl]-2-oxoazepan-3-yl]-N-(2-methyl-1-benzofuran-5-yl)-2-nitroethanimidamide |
|---|---|
| PubChem CID | 91390411 |
| Molecular Formula | C23H24N4O6 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | N'-[(3S)-1-[2-(furan-3-yl)-2-oxoethyl]-2-oxoazepan-3-yl]-N-(2-methyl-1-benzofuran-5-yl)-2-nitroethanimidamide |
| SMILES | Cc1cc2cc(N/C(C[N+](=O)[O-])=N\[C@H]3CCCCN(CC(=O)c4ccoc4)C3=O)ccc2o1 |
| InChI | InChI=1S/C23H24N4O6/c1-15-10-17-11-18(5-6-21(17)33-15)24-22(13-27(30)31)25-19-4-2-3-8-26(23(19)29)12-20(28)16-7-9-32-14-16/h5-7,9-11,14,19H,2-4,8,12-13H2,1H3,(H,24,25)/t19-/m0/s1 |
| InChIKey | FVOFDRXKUXMABI-IBGZPJMESA-N |
| XLogP | 3.69 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|