C23H30N8O3 — CID 59970122
2-[1-[2-[(2R)-2-(azidomethyl)pyrrolidin-1-yl]-2-oxoethyl]-2-oxoazepan-3-yl]-1-(2-methyl-1-benzofuran-5-yl)guanidine (PubChem CID 59970122) has the molecular formula C23H30N8O3 and a molecular weight of 466.55 g/mol. Its IUPAC name is 2-[1-[2-[(2R)-2-(azidomethyl)pyrrolidin-1-yl]-2-oxoethyl]-2-oxoazepan-3-yl]-1-(2-methyl-1-benzofuran-5-yl)guanidine.
| Compound Name | 2-[1-[2-[(2R)-2-(azidomethyl)pyrrolidin-1-yl]-2-oxoethyl]-2-oxoazepan-3-yl]-1-(2-methyl-1-benzofuran-5-yl)guanidine |
|---|---|
| PubChem CID | 59970122 |
| Molecular Formula | C23H30N8O3 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 2-[1-[2-[(2R)-2-(azidomethyl)pyrrolidin-1-yl]-2-oxoethyl]-2-oxoazepan-3-yl]-1-(2-methyl-1-benzofuran-5-yl)guanidine |
| SMILES | Cc1cc2cc(N/C(N)=N/C3CCCCN(CC(=O)N4CCC[C@@H]4CN=[N+]=[N-])C3=O)ccc2o1 |
| InChI | InChI=1S/C23H30N8O3/c1-15-11-16-12-17(7-8-20(16)34-15)27-23(24)28-19-6-2-3-9-30(22(19)33)14-21(32)31-10-4-5-18(31)13-26-29-25/h7-8,11-12,18-19H,2-6,9-10,13-14H2,1H3,(H3,24,27,28)/t18-,19?/m1/s1 |
| InChIKey | YRIUOEBLGVWKIU-MRTLOADZSA-N |
| XLogP | 3.15 |
| TPSA | 152.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|