C26H31N5O5 — CID 90695804
methyl 2-cyano-3-[(2-methyl-1-benzofuran-5-yl)amino]-3-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]iminopropanoate (PubChem CID 90695804) has the molecular formula C26H31N5O5 and a molecular weight of 493.56 g/mol. Its IUPAC name is methyl 2-cyano-3-[(2-methyl-1-benzofuran-5-yl)amino]-3-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]iminopropanoate.
| Compound Name | methyl 2-cyano-3-[(2-methyl-1-benzofuran-5-yl)amino]-3-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]iminopropanoate |
|---|---|
| PubChem CID | 90695804 |
| Molecular Formula | C26H31N5O5 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | methyl 2-cyano-3-[(2-methyl-1-benzofuran-5-yl)amino]-3-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]iminopropanoate |
| SMILES | COC(=O)C(C#N)/C(=N\[C@H]1CCCCN(CC(=O)N2CCCC2)C1=O)Nc1ccc2oc(C)cc2c1 |
| InChI | InChI=1S/C26H31N5O5/c1-17-13-18-14-19(8-9-22(18)36-17)28-24(20(15-27)26(34)35-2)29-21-7-3-4-12-31(25(21)33)16-23(32)30-10-5-6-11-30/h8-9,13-14,20-21H,3-7,10-12,16H2,1-2H3,(H,28,29)/t20?,21-/m0/s1 |
| InChIKey | OCSBLCNXYUFLSM-LBAQZLPGSA-N |
| XLogP | 2.87 |
| TPSA | 128.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|