C24H28N6O3 — CID 91096694
2,2-dicyano-N-(2,3-dihydro-1-benzofuran-5-yl)-N'-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]ethanimidamide (PubChem CID 91096694) has the molecular formula C24H28N6O3 and a molecular weight of 448.53 g/mol. Its IUPAC name is 2,2-dicyano-N-(2,3-dihydro-1-benzofuran-5-yl)-N'-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]ethanimidamide.
| Compound Name | 2,2-dicyano-N-(2,3-dihydro-1-benzofuran-5-yl)-N'-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]ethanimidamide |
|---|---|
| PubChem CID | 91096694 |
| Molecular Formula | C24H28N6O3 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 2,2-dicyano-N-(2,3-dihydro-1-benzofuran-5-yl)-N'-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]ethanimidamide |
| SMILES | N#CC(C#N)/C(=N\[C@H]1CCCCN(CC(=O)N2CCCC2)C1=O)Nc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C24H28N6O3/c25-14-18(15-26)23(27-19-6-7-21-17(13-19)8-12-33-21)28-20-5-1-2-11-30(24(20)32)16-22(31)29-9-3-4-10-29/h6-7,13,18,20H,1-5,8-12,16H2,(H,27,28)/t20-/m0/s1 |
| InChIKey | KNCNHCDVDAOYNT-FQEVSTJZSA-N |
| XLogP | 2.10 |
| TPSA | 121.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|