C25H30N6O5 — CID 91601577
methyl 2-cyano-3-[(2-oxo-1,3-dihydroindol-7-yl)amino]-3-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]iminopropanoate (PubChem CID 91601577) has the molecular formula C25H30N6O5 and a molecular weight of 494.55 g/mol. Its IUPAC name is methyl 2-cyano-3-[(2-oxo-1,3-dihydroindol-7-yl)amino]-3-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]iminopropanoate.
| Compound Name | methyl 2-cyano-3-[(2-oxo-1,3-dihydroindol-7-yl)amino]-3-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]iminopropanoate |
|---|---|
| PubChem CID | 91601577 |
| Molecular Formula | C25H30N6O5 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | methyl 2-cyano-3-[(2-oxo-1,3-dihydroindol-7-yl)amino]-3-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]iminopropanoate |
| SMILES | COC(=O)C(C#N)/C(=N\C1CCCCN(CC(=O)N2CCCC2)C1=O)Nc1cccc2c1NC(=O)C2 |
| InChI | InChI=1S/C25H30N6O5/c1-36-25(35)17(14-26)23(27-18-9-6-7-16-13-20(32)29-22(16)18)28-19-8-2-3-12-31(24(19)34)15-21(33)30-10-4-5-11-30/h6-7,9,17,19H,2-5,8,10-13,15H2,1H3,(H,27,28)(H,29,32) |
| InChIKey | KJYJCNTUWCEJRU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 144.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|