C13H17BrN2O3S2 — CID 43043075
[1-(5-bromothiophen-2-yl)sulfonylpyrrolidin-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 43043075) has the molecular formula C13H17BrN2O3S2 and a molecular weight of 393.33 g/mol. Its IUPAC name is [1-(5-bromothiophen-2-yl)sulfonylpyrrolidin-2-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [1-(5-bromothiophen-2-yl)sulfonylpyrrolidin-2-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 43043075 |
| Molecular Formula | C13H17BrN2O3S2 |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | [1-(5-bromothiophen-2-yl)sulfonylpyrrolidin-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(C1CCCN1S(=O)(=O)c1ccc(Br)s1)N1CCCC1 |
| InChI | InChI=1S/C13H17BrN2O3S2/c14-11-5-6-12(20-11)21(18,19)16-9-3-4-10(16)13(17)15-7-1-2-8-15/h5-6,10H,1-4,7-9H2 |
| InChIKey | TXLVLFFRFLHBJN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |