C16H22N2O3S — CID 7221204
[(2R)-1-(benzenesulfonyl)piperidin-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 7221204) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is [(2R)-1-(benzenesulfonyl)piperidin-2-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(2R)-1-(benzenesulfonyl)piperidin-2-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 7221204 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | [(2R)-1-(benzenesulfonyl)piperidin-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C([C@H]1CCCCN1S(=O)(=O)c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C16H22N2O3S/c19-16(17-11-6-7-12-17)15-10-4-5-13-18(15)22(20,21)14-8-2-1-3-9-14/h1-3,8-9,15H,4-7,10-13H2/t15-/m1/s1 |
| InChIKey | PEYCNQWEJDIIIN-OAHLLOKOSA-N |
| XLogP | 1.85 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |