C21H24FN3O3S — CID 42702670
[1-(benzenesulfonyl)pyrrolidin-2-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 42702670) has the molecular formula C21H24FN3O3S and a molecular weight of 417.51 g/mol. Its IUPAC name is [1-(benzenesulfonyl)pyrrolidin-2-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | [1-(benzenesulfonyl)pyrrolidin-2-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42702670 |
| Molecular Formula | C21H24FN3O3S |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | [1-(benzenesulfonyl)pyrrolidin-2-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(C1CCCN1S(=O)(=O)c1ccccc1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C21H24FN3O3S/c22-18-9-4-5-10-19(18)23-13-15-24(16-14-23)21(26)20-11-6-12-25(20)29(27,28)17-7-2-1-3-8-17/h1-5,7-10,20H,6,11-16H2 |
| InChIKey | LMJJTCSPMQOMRZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |