C23H29N3O3S — CID 1190427
[(2S)-1-(benzenesulfonyl)piperidin-2-yl]-(4-benzylpiperazin-1-yl)methanone (PubChem CID 1190427) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is [(2S)-1-(benzenesulfonyl)piperidin-2-yl]-(4-benzylpiperazin-1-yl)methanone.
| Compound Name | [(2S)-1-(benzenesulfonyl)piperidin-2-yl]-(4-benzylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 1190427 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | [(2S)-1-(benzenesulfonyl)piperidin-2-yl]-(4-benzylpiperazin-1-yl)methanone |
| SMILES | O=C([C@@H]1CCCCN1S(=O)(=O)c1ccccc1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H29N3O3S/c27-23(25-17-15-24(16-18-25)19-20-9-3-1-4-10-20)22-13-7-8-14-26(22)30(28,29)21-11-5-2-6-12-21/h1-6,9-12,22H,7-8,13-19H2/t22-/m0/s1 |
| InChIKey | HDCVTGMPTXIULD-QFIPXVFZSA-N |
| XLogP | 2.57 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |