C23H26N4O3S — CID 24730458
3-[4-benzyl-2-(pyrrolidine-1-carbonyl)piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 24730458) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is 3-[4-benzyl-2-(pyrrolidine-1-carbonyl)piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 3-[4-benzyl-2-(pyrrolidine-1-carbonyl)piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 24730458 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 3-[4-benzyl-2-(pyrrolidine-1-carbonyl)piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1cccc(S(=O)(=O)N2CCN(Cc3ccccc3)CC2C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C23H26N4O3S/c24-16-20-9-6-10-21(15-20)31(29,30)27-14-13-25(17-19-7-2-1-3-8-19)18-22(27)23(28)26-11-4-5-12-26/h1-3,6-10,15,22H,4-5,11-14,17-18H2 |
| InChIKey | CCZATZYNODQKMP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |