C19H17Cl2N3O3S — CID 42956538
1-(3-cyanophenyl)sulfonyl-N-(3,4-dichlorophenyl)piperidine-2-carboxamide (PubChem CID 42956538) has the molecular formula C19H17Cl2N3O3S and a molecular weight of 438.34 g/mol. Its IUPAC name is 1-(3-cyanophenyl)sulfonyl-N-(3,4-dichlorophenyl)piperidine-2-carboxamide.
| Compound Name | 1-(3-cyanophenyl)sulfonyl-N-(3,4-dichlorophenyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 42956538 |
| Molecular Formula | C19H17Cl2N3O3S |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 1-(3-cyanophenyl)sulfonyl-N-(3,4-dichlorophenyl)piperidine-2-carboxamide |
| SMILES | N#Cc1cccc(S(=O)(=O)N2CCCCC2C(=O)Nc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C19H17Cl2N3O3S/c20-16-8-7-14(11-17(16)21)23-19(25)18-6-1-2-9-24(18)28(26,27)15-5-3-4-13(10-15)12-22/h3-5,7-8,10-11,18H,1-2,6,9H2,(H,23,25) |
| InChIKey | HNWQWOSUCOBDMP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |