C19H19N3O3S — CID 18077712
1-(benzenesulfonyl)-N-(4-cyanophenyl)piperidine-2-carboxamide (PubChem CID 18077712) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(4-cyanophenyl)piperidine-2-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-(4-cyanophenyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 18077712 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(4-cyanophenyl)piperidine-2-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)C2CCCCN2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19N3O3S/c20-14-15-9-11-16(12-10-15)21-19(23)18-8-4-5-13-22(18)26(24,25)17-6-2-1-3-7-17/h1-3,6-7,9-12,18H,4-5,8,13H2,(H,21,23) |
| InChIKey | ZPCKOEGSMHHHEK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |