C20H22N2O5S — CID 8765077
methyl 4-[[(2R)-1-(benzenesulfonyl)piperidine-2-carbonyl]amino]benzoate (PubChem CID 8765077) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is methyl 4-[[(2R)-1-(benzenesulfonyl)piperidine-2-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[(2R)-1-(benzenesulfonyl)piperidine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 8765077 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | methyl 4-[[(2R)-1-(benzenesulfonyl)piperidine-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)[C@H]2CCCCN2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H22N2O5S/c1-27-20(24)15-10-12-16(13-11-15)21-19(23)18-9-5-6-14-22(18)28(25,26)17-7-3-2-4-8-17/h2-4,7-8,10-13,18H,5-6,9,14H2,1H3,(H,21,23)/t18-/m1/s1 |
| InChIKey | NTGNRFHIADQBOP-GOSISDBHSA-N |
| XLogP | 2.66 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |