C25H25N3O5S — CID 43059447
1-(benzenesulfonyl)-N-[4-[(2-methoxyphenyl)carbamoyl]phenyl]pyrrolidine-2-carboxamide (PubChem CID 43059447) has the molecular formula C25H25N3O5S and a molecular weight of 479.56 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[4-[(2-methoxyphenyl)carbamoyl]phenyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[4-[(2-methoxyphenyl)carbamoyl]phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 43059447 |
| Molecular Formula | C25H25N3O5S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[4-[(2-methoxyphenyl)carbamoyl]phenyl]pyrrolidine-2-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1ccc(NC(=O)C2CCCN2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N3O5S/c1-33-23-12-6-5-10-21(23)27-24(29)18-13-15-19(16-14-18)26-25(30)22-11-7-17-28(22)34(31,32)20-8-3-2-4-9-20/h2-6,8-10,12-16,22H,7,11,17H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | WLKWDVMDYJQLRH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |