C21H23N3O6S — CID 43059754
methyl 2-[[4-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]benzoyl]amino]acetate (PubChem CID 43059754) has the molecular formula C21H23N3O6S and a molecular weight of 445.50 g/mol. Its IUPAC name is methyl 2-[[4-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[4-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 43059754 |
| Molecular Formula | C21H23N3O6S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | methyl 2-[[4-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(NC(=O)C2CCCN2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23N3O6S/c1-30-19(25)14-22-20(26)15-9-11-16(12-10-15)23-21(27)18-8-5-13-24(18)31(28,29)17-6-3-2-4-7-17/h2-4,6-7,9-12,18H,5,8,13-14H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | NBKVJMIJBMRJFH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |