C19H19F3N2O4S — CID 2648500
(2S)-1-(benzenesulfonyl)-N-[4-(trifluoromethoxy)phenyl]piperidine-2-carboxamide (PubChem CID 2648500) has the molecular formula C19H19F3N2O4S and a molecular weight of 428.43 g/mol. Its IUPAC name is (2S)-1-(benzenesulfonyl)-N-[4-(trifluoromethoxy)phenyl]piperidine-2-carboxamide.
| Compound Name | (2S)-1-(benzenesulfonyl)-N-[4-(trifluoromethoxy)phenyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 2648500 |
| Molecular Formula | C19H19F3N2O4S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | (2S)-1-(benzenesulfonyl)-N-[4-(trifluoromethoxy)phenyl]piperidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)[C@@H]1CCCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H19F3N2O4S/c20-19(21,22)28-15-11-9-14(10-12-15)23-18(25)17-8-4-5-13-24(17)29(26,27)16-6-2-1-3-7-16/h1-3,6-7,9-12,17H,4-5,8,13H2,(H,23,25)/t17-/m0/s1 |
| InChIKey | FMTQXCHCCAADGX-KRWDZBQOSA-N |
| XLogP | 3.77 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |