C18H15F3N2O5S — CID 46351356
1-(benzenesulfonyl)-5-oxo-N-[4-(trifluoromethoxy)phenyl]pyrrolidine-2-carboxamide (PubChem CID 46351356) has the molecular formula C18H15F3N2O5S and a molecular weight of 428.39 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5-oxo-N-[4-(trifluoromethoxy)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-5-oxo-N-[4-(trifluoromethoxy)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 46351356 |
| Molecular Formula | C18H15F3N2O5S |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 1-(benzenesulfonyl)-5-oxo-N-[4-(trifluoromethoxy)phenyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)C1CCC(=O)N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H15F3N2O5S/c19-18(20,21)28-13-8-6-12(7-9-13)22-17(25)15-10-11-16(24)23(15)29(26,27)14-4-2-1-3-5-14/h1-9,15H,10-11H2,(H,22,25) |
| InChIKey | MVZVDAOEAUMBFX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |