C18H17FN2O5S — CID 93072370
(2S)-1-(4-fluorophenyl)sulfonyl-N-(2-methoxyphenyl)-5-oxopyrrolidine-2-carboxamide (PubChem CID 93072370) has the molecular formula C18H17FN2O5S and a molecular weight of 392.41 g/mol. Its IUPAC name is (2S)-1-(4-fluorophenyl)sulfonyl-N-(2-methoxyphenyl)-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(4-fluorophenyl)sulfonyl-N-(2-methoxyphenyl)-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 93072370 |
| Molecular Formula | C18H17FN2O5S |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | (2S)-1-(4-fluorophenyl)sulfonyl-N-(2-methoxyphenyl)-5-oxopyrrolidine-2-carboxamide |
| SMILES | COc1ccccc1NC(=O)[C@@H]1CCC(=O)N1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H17FN2O5S/c1-26-16-5-3-2-4-14(16)20-18(23)15-10-11-17(22)21(15)27(24,25)13-8-6-12(19)7-9-13/h2-9,15H,10-11H2,1H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | HUOSTABEPTWRAC-HNNXBMFYSA-N |
| XLogP | 2.15 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |