C20H19FN2O6S — CID 93059322
ethyl 3-[[(2R)-1-(4-fluorophenyl)sulfonyl-5-oxopyrrolidine-2-carbonyl]amino]benzoate (PubChem CID 93059322) has the molecular formula C20H19FN2O6S and a molecular weight of 434.45 g/mol. Its IUPAC name is ethyl 3-[[(2R)-1-(4-fluorophenyl)sulfonyl-5-oxopyrrolidine-2-carbonyl]amino]benzoate.
| Compound Name | ethyl 3-[[(2R)-1-(4-fluorophenyl)sulfonyl-5-oxopyrrolidine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 93059322 |
| Molecular Formula | C20H19FN2O6S |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | ethyl 3-[[(2R)-1-(4-fluorophenyl)sulfonyl-5-oxopyrrolidine-2-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)[C@H]2CCC(=O)N2S(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H19FN2O6S/c1-2-29-20(26)13-4-3-5-15(12-13)22-19(25)17-10-11-18(24)23(17)30(27,28)16-8-6-14(21)7-9-16/h3-9,12,17H,2,10-11H2,1H3,(H,22,25)/t17-/m1/s1 |
| InChIKey | OHMPOPXFRPSLKQ-QGZVFWFLSA-N |
| XLogP | 2.32 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |