C18H24N2O4S — CID 110387732
1-(benzenesulfonyl)-N-cycloheptyl-5-oxopyrrolidine-2-carboxamide (PubChem CID 110387732) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-cycloheptyl-5-oxopyrrolidine-2-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-cycloheptyl-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110387732 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1-(benzenesulfonyl)-N-cycloheptyl-5-oxopyrrolidine-2-carboxamide |
| SMILES | O=C(NC1CCCCCC1)C1CCC(=O)N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H24N2O4S/c21-17-13-12-16(18(22)19-14-8-4-1-2-5-9-14)20(17)25(23,24)15-10-6-3-7-11-15/h3,6-7,10-11,14,16H,1-2,4-5,8-9,12-13H2,(H,19,22) |
| InChIKey | CCXFEKYHVQYURB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |