C21H29N3O4S — CID 92751774
(5S)-1-(benzenesulfonyl)-5-(4-cyclohexylpiperazine-1-carbonyl)pyrrolidin-2-one (PubChem CID 92751774) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is (5S)-1-(benzenesulfonyl)-5-(4-cyclohexylpiperazine-1-carbonyl)pyrrolidin-2-one.
| Compound Name | (5S)-1-(benzenesulfonyl)-5-(4-cyclohexylpiperazine-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 92751774 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | (5S)-1-(benzenesulfonyl)-5-(4-cyclohexylpiperazine-1-carbonyl)pyrrolidin-2-one |
| SMILES | O=C([C@@H]1CCC(=O)N1S(=O)(=O)c1ccccc1)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C21H29N3O4S/c25-20-12-11-19(24(20)29(27,28)18-9-5-2-6-10-18)21(26)23-15-13-22(14-16-23)17-7-3-1-4-8-17/h2,5-6,9-10,17,19H,1,3-4,7-8,11-16H2/t19-/m0/s1 |
| InChIKey | XWJRWVGASSLKAM-IBGZPJMESA-N |
| XLogP | 1.84 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |