C22H31N3O4S — CID 93059296
(5R)-1-(4-methylphenyl)sulfonyl-5-(4-piperidin-1-ylpiperidine-1-carbonyl)pyrrolidin-2-one (PubChem CID 93059296) has the molecular formula C22H31N3O4S and a molecular weight of 433.57 g/mol. Its IUPAC name is (5R)-1-(4-methylphenyl)sulfonyl-5-(4-piperidin-1-ylpiperidine-1-carbonyl)pyrrolidin-2-one.
| Compound Name | (5R)-1-(4-methylphenyl)sulfonyl-5-(4-piperidin-1-ylpiperidine-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 93059296 |
| Molecular Formula | C22H31N3O4S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | (5R)-1-(4-methylphenyl)sulfonyl-5-(4-piperidin-1-ylpiperidine-1-carbonyl)pyrrolidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)CC[C@@H]2C(=O)N2CCC(N3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C22H31N3O4S/c1-17-5-7-19(8-6-17)30(28,29)25-20(9-10-21(25)26)22(27)24-15-11-18(12-16-24)23-13-3-2-4-14-23/h5-8,18,20H,2-4,9-16H2,1H3/t20-/m1/s1 |
| InChIKey | TUXMXXGZPIANSU-HXUWFJFHSA-N |
| XLogP | 2.15 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |