C17H23N3O4S — CID 1093274
(5S)-1-(4-methylphenyl)sulfonyl-5-(4-methylpiperazine-1-carbonyl)pyrrolidin-2-one (PubChem CID 1093274) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is (5S)-1-(4-methylphenyl)sulfonyl-5-(4-methylpiperazine-1-carbonyl)pyrrolidin-2-one.
| Compound Name | (5S)-1-(4-methylphenyl)sulfonyl-5-(4-methylpiperazine-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 1093274 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (5S)-1-(4-methylphenyl)sulfonyl-5-(4-methylpiperazine-1-carbonyl)pyrrolidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)CC[C@H]2C(=O)N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C17H23N3O4S/c1-13-3-5-14(6-4-13)25(23,24)20-15(7-8-16(20)21)17(22)19-11-9-18(2)10-12-19/h3-6,15H,7-12H2,1-2H3/t15-/m0/s1 |
| InChIKey | GQTWUGGTDHTKKZ-HNNXBMFYSA-N |
| XLogP | 0.45 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |