C22H31N3O4S — CID 55567553
[4-[1-(benzenesulfonyl)piperidine-2-carbonyl]piperazin-1-yl]-cyclopentylmethanone (PubChem CID 55567553) has the molecular formula C22H31N3O4S and a molecular weight of 433.57 g/mol. Its IUPAC name is [4-[1-(benzenesulfonyl)piperidine-2-carbonyl]piperazin-1-yl]-cyclopentylmethanone.
| Compound Name | [4-[1-(benzenesulfonyl)piperidine-2-carbonyl]piperazin-1-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 55567553 |
| Molecular Formula | C22H31N3O4S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | [4-[1-(benzenesulfonyl)piperidine-2-carbonyl]piperazin-1-yl]-cyclopentylmethanone |
| SMILES | O=C(C1CCCC1)N1CCN(C(=O)C2CCCCN2S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H31N3O4S/c26-21(18-8-4-5-9-18)23-14-16-24(17-15-23)22(27)20-12-6-7-13-25(20)30(28,29)19-10-2-1-3-11-19/h1-3,10-11,18,20H,4-9,12-17H2 |
| InChIKey | GJUINCZQHYAXAO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |