C18H25NO3S — CID 110661946
[4-(benzenesulfonylmethyl)piperidin-1-yl]-cyclopentylmethanone (PubChem CID 110661946) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is [4-(benzenesulfonylmethyl)piperidin-1-yl]-cyclopentylmethanone.
| Compound Name | [4-(benzenesulfonylmethyl)piperidin-1-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 110661946 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | [4-(benzenesulfonylmethyl)piperidin-1-yl]-cyclopentylmethanone |
| SMILES | O=C(C1CCCC1)N1CCC(CS(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H25NO3S/c20-18(16-6-4-5-7-16)19-12-10-15(11-13-19)14-23(21,22)17-8-2-1-3-9-17/h1-3,8-9,15-16H,4-7,10-14H2 |
| InChIKey | JQBQPCWQQDQNDF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |