C17H22N2O6S — CID 119251462
1-[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]-4-hydroxypiperidine-4-carboxylic acid (PubChem CID 119251462) has the molecular formula C17H22N2O6S and a molecular weight of 382.44 g/mol. Its IUPAC name is 1-[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]-4-hydroxypiperidine-4-carboxylic acid.
| Compound Name | 1-[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]-4-hydroxypiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119251462 |
| Molecular Formula | C17H22N2O6S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 1-[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]-4-hydroxypiperidine-4-carboxylic acid |
| SMILES | O=C(C1CCCN1S(=O)(=O)c1ccccc1)N1CCC(O)(C(=O)O)CC1 |
| InChI | InChI=1S/C17H22N2O6S/c20-15(18-11-8-17(23,9-12-18)16(21)22)14-7-4-10-19(14)26(24,25)13-5-2-1-3-6-13/h1-3,5-6,14,23H,4,7-12H2,(H,21,22) |
| InChIKey | WQPHPZPYUKTMKC-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |