C22H28N4O3S — CID 55447550
[1-(benzenesulfonyl)piperidin-2-yl]-[4-(pyridin-2-ylmethyl)piperazin-1-yl]methanone (PubChem CID 55447550) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is [1-(benzenesulfonyl)piperidin-2-yl]-[4-(pyridin-2-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | [1-(benzenesulfonyl)piperidin-2-yl]-[4-(pyridin-2-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55447550 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | [1-(benzenesulfonyl)piperidin-2-yl]-[4-(pyridin-2-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(C1CCCCN1S(=O)(=O)c1ccccc1)N1CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C22H28N4O3S/c27-22(25-16-14-24(15-17-25)18-19-8-4-6-12-23-19)21-11-5-7-13-26(21)30(28,29)20-9-2-1-3-10-20/h1-4,6,8-10,12,21H,5,7,11,13-18H2 |
| InChIKey | ASLMYWHAHANYMD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |