C16H27Cl3N4O — CID 119901139
[(2S)-piperidin-2-yl]-[4-(pyridin-2-ylmethyl)piperazin-1-yl]methanone;trihydrochloride (PubChem CID 119901139) has the molecular formula C16H27Cl3N4O and a molecular weight of 397.78 g/mol. Its IUPAC name is [(2S)-piperidin-2-yl]-[4-(pyridin-2-ylmethyl)piperazin-1-yl]methanone;trihydrochloride.
| Compound Name | [(2S)-piperidin-2-yl]-[4-(pyridin-2-ylmethyl)piperazin-1-yl]methanone;trihydrochloride |
|---|---|
| PubChem CID | 119901139 |
| Molecular Formula | C16H27Cl3N4O |
| Molecular Weight | 397.78 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | [(2S)-piperidin-2-yl]-[4-(pyridin-2-ylmethyl)piperazin-1-yl]methanone;trihydrochloride |
| SMILES | Cl.Cl.Cl.O=C([C@@H]1CCCCN1)N1CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C16H24N4O.3ClH/c21-16(15-6-2-4-8-18-15)20-11-9-19(10-12-20)13-14-5-1-3-7-17-14;;;/h1,3,5,7,15,18H,2,4,6,8-13H2;3*1H/t15-;;;/m0.../s1 |
| InChIKey | GLHYNMNRAZXLMA-CFZZCFLMSA-N |
| XLogP | 2.13 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.78 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |