C25H31N3O4S — CID 43060932
[1-(benzenesulfonyl)piperidin-2-yl]-[4-(4-ethylbenzoyl)piperazin-1-yl]methanone (PubChem CID 43060932) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is [1-(benzenesulfonyl)piperidin-2-yl]-[4-(4-ethylbenzoyl)piperazin-1-yl]methanone.
| Compound Name | [1-(benzenesulfonyl)piperidin-2-yl]-[4-(4-ethylbenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 43060932 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | [1-(benzenesulfonyl)piperidin-2-yl]-[4-(4-ethylbenzoyl)piperazin-1-yl]methanone |
| SMILES | CCc1ccc(C(=O)N2CCN(C(=O)C3CCCCN3S(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H31N3O4S/c1-2-20-11-13-21(14-12-20)24(29)26-16-18-27(19-17-26)25(30)23-10-6-7-15-28(23)33(31,32)22-8-4-3-5-9-22/h3-5,8-9,11-14,23H,2,6-7,10,15-19H2,1H3 |
| InChIKey | LIDLNDZAQSUTGH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |