C11H12ClN3O4S — CID 4767736
1-(4-chlorophenyl)sulfonyl-5-oxopyrrolidine-2-carbohydrazide (PubChem CID 4767736) has the molecular formula C11H12ClN3O4S and a molecular weight of 317.75 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-5-oxopyrrolidine-2-carbohydrazide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-5-oxopyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 4767736 |
| Molecular Formula | C11H12ClN3O4S |
| Molecular Weight | 317.75 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-5-oxopyrrolidine-2-carbohydrazide |
| SMILES | NNC(=O)C1CCC(=O)N1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H12ClN3O4S/c12-7-1-3-8(4-2-7)20(18,19)15-9(11(17)14-13)5-6-10(15)16/h1-4,9H,5-6,13H2,(H,14,17) |
| InChIKey | CDLXWBIYWXFKGV-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.75 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|