C19H19ClN3O5S+ — CID 2209564
[amino-(4-chlorophenyl)methylidene]-[(2S)-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2-carbonyl]oxyazanium (PubChem CID 2209564) has the molecular formula C19H19ClN3O5S+ and a molecular weight of 436.90 g/mol. Its IUPAC name is [amino-(4-chlorophenyl)methylidene]-[(2S)-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2-carbonyl]oxyazanium.
| Compound Name | [amino-(4-chlorophenyl)methylidene]-[(2S)-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2-carbonyl]oxyazanium |
|---|---|
| PubChem CID | 2209564 |
| Molecular Formula | C19H19ClN3O5S+ |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | [amino-(4-chlorophenyl)methylidene]-[(2S)-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2-carbonyl]oxyazanium |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)CC[C@H]2C(=O)O[NH+]=C(N)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H18ClN3O5S/c1-12-2-8-15(9-3-12)29(26,27)23-16(10-11-17(23)24)19(25)28-22-18(21)13-4-6-14(20)7-5-13/h2-9,16H,10-11H2,1H3,(H2,21,22)/p+1/t16-/m0/s1 |
| InChIKey | XAAKBJZBJRHORA-INIZCTEOSA-O |
| XLogP | 0.27 |
| TPSA | 120.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|