C18H23FN2O4S — CID 53008162
1-(4-fluorophenyl)sulfonyl-N-(4-methylcyclohexyl)-5-oxopyrrolidine-2-carboxamide (PubChem CID 53008162) has the molecular formula C18H23FN2O4S and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-N-(4-methylcyclohexyl)-5-oxopyrrolidine-2-carboxamide.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-N-(4-methylcyclohexyl)-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 53008162 |
| Molecular Formula | C18H23FN2O4S |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-N-(4-methylcyclohexyl)-5-oxopyrrolidine-2-carboxamide |
| SMILES | CC1CCC(NC(=O)C2CCC(=O)N2S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H23FN2O4S/c1-12-2-6-14(7-3-12)20-18(23)16-10-11-17(22)21(16)26(24,25)15-8-4-13(19)5-9-15/h4-5,8-9,12,14,16H,2-3,6-7,10-11H2,1H3,(H,20,23) |
| InChIKey | IDZKEWRYOXNJOI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |